ChemNet > CAS > 92643-16-8 6-bromo-1-(chloromethyl)-2-methoxynaphthalene
92643-16-8 6-bromo-1-(chloromethyl)-2-methoxynaphthalene
Nama produk |
6-bromo-1-(chloromethyl)-2-methoxynaphthalene |
Sinonim |
w6-Bromo-1-(chloromethyl)-2-methoxynaphthalene |
MF |
C12H10BrClO |
Berat Molekul |
285.5642 |
InChI |
InChI=1/C12H10BrClO/c1-15-12-5-2-8-6-9(13)3-4-10(8)11(12)7-14/h2-6H,7H2,1H3 |
CAS NO |
92643-16-8 |
Struktur Molekul |
|
Kepadatan |
1.491g/cm3 |
Titik lebur |
144℃ |
Titik didih |
379.5°C at 760 mmHg |
Indeks bias |
1.631 |
Titik nyala |
183.3°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|