ChemNet > CAS > 927-67-3 n-Propylthiourea
927-67-3 n-Propylthiourea
Nama produk |
n-Propylthiourea |
Sinonim |
Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
MF |
C4H10N2S |
Berat Molekul |
118.2006 |
InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
CAS NO |
927-67-3 |
EINECS |
213-158-2 |
Struktur Molekul |
|
Kepadatan |
1.054g/cm3 |
Titik didih |
182.1°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
63.9°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|