ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
Nama produk |
p-Tolyl chlorothionoformate |
Sinonim |
p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
MF |
C8H7ClOS |
Berat Molekul |
186.6586 |
InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
CAS NO |
937-63-3 |
EINECS |
213-333-3 |
Struktur Molekul |
|
Kepadatan |
1.277g/cm3 |
Titik didih |
244.8°C at 760 mmHg |
Indeks bias |
1.598 |
Titik nyala |
101.8°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|