ChemNet > CAS > 10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
Naam product |
Dimethyl 1,1-cyclobutanedicarboxylate |
Synoniemen |
1,1-Cyclobutanedicarboxylic acid dimethyl ester; Dimethyl1,1-cyclobutanedicarboxylate, (1,1-Cyclobutanedicarboxylicacid dimethylester); dimethyl cyclobutane-1,1-dicarboxylate |
MF |
C8H12O4 |
Molecuulgewicht |
172.1785 |
InChI |
InChI=1/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
CAS-nummer |
10224-72-3 |
Moleculaire Structuur |
|
Dichtheid |
1.19g/cm3 |
Kookpunt |
182.6°C at 760 mmHg |
Brekingsindex |
1.468 |
Vlampunt |
79.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|