ChemNet > CAS > 10323-20-3;28697-53-2 D(-)-Arabinose
10323-20-3;28697-53-2 D(-)-Arabinose
Naam product |
D(-)-Arabinose |
Synoniemen |
Arabinose(D); D-(-)-Arabinose; D-arabinopyranose; beta-L-arabinopyranose; .beta.-D-Arabinopyranose; beta-D-arabinopyranose; alpha-D-arabinopyranose; D-Arabinose; pectinose; Pectin sugar; beta-D-(-)-Arabinose |
MF |
C5H10O5 |
Molecuulgewicht |
150.1299 |
InChI |
InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m0/s1 |
CAS-nummer |
10323-20-3;28697-53-2 |
EINECS |
233-708-5 |
Moleculaire Structuur |
|
Dichtheid |
1.757g/cm3 |
Smeltpunt |
152-160℃ |
Kookpunt |
333.2°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
155.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|