ChemNet > CAS > 10389-51-2 4-(4-nitrophenyl)morpholine
10389-51-2 4-(4-nitrophenyl)morpholine
Naam product |
4-(4-nitrophenyl)morpholine |
Synoniemen |
Morpholine, 4-(4-nitrophenyl)-; 4-(4-Nitrophenyl)morpholine; 4-(p-Nitrophenyl)morpholine; 4-27-00-00037 (Beilstein Handbook Reference); 4-Morpholinyl nitrobenzene; BRN 0210854; Morpholine, 4-(p-nitrophenyl)-; N-(p-Nitrophenyl)-morpholine; NSC 27271; p-Morpholinonitrobenzene |
MF |
C10H12N2O3 |
Molecuulgewicht |
208.2139 |
InChI |
InChI=1/C10H12N2O3/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11/h1-4H,5-8H2 |
CAS-nummer |
10389-51-2 |
EINECS |
233-851-3 |
Moleculaire Structuur |
|
Dichtheid |
1.265g/cm3 |
Smeltpunt |
150℃ |
Kookpunt |
386.2°C at 760 mmHg |
Brekingsindex |
1.577 |
Vlampunt |
187.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|