ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
| Naam product |
3-Hydroxyphenylacetylene |
| Synoniemen |
3-Ethynylphenol |
| MF |
C8H6O |
| Molecuulgewicht |
118.1326 |
| InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS-nummer |
10401-11-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.12g/cm3 |
| Kookpunt |
230.9°C at 760 mmHg |
| Brekingsindex |
1.589 |
| Vlampunt |
106.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
