ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
Naam product |
3-Hydroxyphenylacetylene |
Synoniemen |
3-Ethynylphenol |
MF |
C8H6O |
Molecuulgewicht |
118.1326 |
InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS-nummer |
10401-11-3 |
Moleculaire Structuur |
|
Dichtheid |
1.12g/cm3 |
Kookpunt |
230.9°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
106.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|