ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
| Naam product |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
| Synoniemen |
2-Chloro-6-fluoro-m-tolualdehyde |
| MF |
C8H6ClFO |
| Molecuulgewicht |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
| CAS-nummer |
104451-99-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.292g/cm3 |
| Smeltpunt |
30-33℃ |
| Kookpunt |
225.1°C at 760 mmHg |
| Brekingsindex |
1.552 |
| Vlampunt |
89.9°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
