ChemNet > CAS > 105-05-5 1,4-Diethylbenzene
105-05-5 1,4-Diethylbenzene
| Naam product |
1,4-Diethylbenzene |
| Synoniemen |
Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
| MF |
C10H14 |
| Molecuulgewicht |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| CAS-nummer |
105-05-5 |
| EINECS |
203-265-2 |
| Moleculaire Structuur |
|
| Dichtheid |
0.86g/cm3 |
| Smeltpunt |
-43℃ |
| Kookpunt |
173.3°C at 760 mmHg |
| Brekingsindex |
1.489 |
| Vlampunt |
46.3°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
