ChemNet > CAS > 105799-69-7 4-Chloro-6-fluoro-2H-benzopyran-3-carboxaldehyde
105799-69-7 4-Chloro-6-fluoro-2H-benzopyran-3-carboxaldehyde
Naam product |
4-Chloro-6-fluoro-2H-benzopyran-3-carboxaldehyde |
Synoniemen |
Chlorofluorobenzopyrancarboxaldehyde; 4-Chloro-6-fluoro-2H-chromene-3-carbaldehyde |
MF |
C10H6ClFO2 |
Molecuulgewicht |
212.6048 |
InChI |
InChI=1/C10H6ClFO2/c11-10-6(4-13)5-14-9-2-1-7(12)3-8(9)10/h1-4H,5H2 |
CAS-nummer |
105799-69-7 |
Moleculaire Structuur |
|
Dichtheid |
1.42g/cm3 |
Smeltpunt |
84-86℃ |
Kookpunt |
332.6°C at 760 mmHg |
Brekingsindex |
1.579 |
Vlampunt |
154.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|