ChemNet > CAS > 1074-12-0 Phenylglyoxal monohydrate
1074-12-0 Phenylglyoxal monohydrate
| Naam product |
Phenylglyoxal monohydrate |
| Synoniemen |
benzoylformaldehyde; Phenylgloxal monohydrate; oxo(phenyl)acetaldehyde; oxo(phenyl)acetaldehyde hydrate (1:1) |
| MF |
C8H8O3 |
| Molecuulgewicht |
152.1473 |
| InChI |
InChI=1/C8H6O2.H2O/c9-6-8(10)7-4-2-1-3-5-7;/h1-6H;1H2 |
| CAS-nummer |
1074-12-0 |
| EINECS |
214-036-1 |
| Moleculaire Structuur |
|
| Smeltpunt |
71-76℃ |
| Kookpunt |
293.2°C at 760 mmHg |
| Vlampunt |
131.2°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
