ChemNet > CAS > 108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
| Naam product |
4-Bromo-2,3-dimethyl-6-nitroaniline |
| Synoniemen |
4-Bromo-6-nitro-2,3-xylidine |
| MF |
C8H9BrN2O2 |
| Molecuulgewicht |
245.0733 |
| InChI |
InChI=1/C8H9BrN2O2/c1-4-5(2)8(10)7(11(12)13)3-6(4)9/h3H,10H2,1-2H3 |
| CAS-nummer |
108485-13-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.609g/cm3 |
| Kookpunt |
357.9°C at 760 mmHg |
| Brekingsindex |
1.632 |
| Vlampunt |
170.3°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
