ChemNet > CAS > 109919-26-8 2-bromo-6-chloro-4-(trifluoromethyl)aniline
109919-26-8 2-bromo-6-chloro-4-(trifluoromethyl)aniline
| Naam product |
2-bromo-6-chloro-4-(trifluoromethyl)aniline |
| Synoniemen |
2-Bromo-6-chloro-4-trifluoromethylaniline; 4-Amino-3-bromo-5-chlorobenzotrifluoride; 4,5,5-trifluoropent-4-en-1-ol |
| MF |
C5H7F3O |
| Molecuulgewicht |
140.1037 |
| InChI |
InChI=1/C5H7F3O/c6-4(5(7)8)2-1-3-9/h9H,1-3H2 |
| CAS-nummer |
109919-26-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.185g/cm3 |
| Smeltpunt |
27-32℃ |
| Kookpunt |
149.5°C at 760 mmHg |
| Brekingsindex |
1.374 |
| Vlampunt |
64.4°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
