ChemNet > CAS > 1117-31-3 1,3-butanediol diacetate
1117-31-3 1,3-butanediol diacetate
Naam product |
1,3-butanediol diacetate |
Synoniemen |
1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
MF |
C8H14O4 |
Molecuulgewicht |
174.1944 |
InChI |
InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
CAS-nummer |
1117-31-3 |
EINECS |
214-244-2 |
Moleculaire Structuur |
|
Dichtheid |
1.037g/cm3 |
Kookpunt |
228.8°C at 760 mmHg |
Brekingsindex |
1.421 |
Vlampunt |
102.6°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|