ChemNet > CAS > 1119-60-4 6-heptenoic acid
1119-60-4 6-heptenoic acid
| Naam product |
6-heptenoic acid |
| Synoniemen |
Hept-6-enoic acid |
| MF |
C7H12O2 |
| Molecuulgewicht |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
| CAS-nummer |
1119-60-4 |
| EINECS |
214-283-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.957g/cm3 |
| Kookpunt |
226°C at 760 mmHg |
| Brekingsindex |
1.447 |
| Vlampunt |
113.3°C |
| Gevaarsymbolen |
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
