ChemNet > CAS > 114569-84-5 1-Dodecyl-3-methylimidazolium chloride
114569-84-5 1-Dodecyl-3-methylimidazolium chloride
Naam product |
1-Dodecyl-3-methylimidazolium chloride |
MF |
C16H33ClN2 |
Molecuulgewicht |
288.8996 |
InChI |
InChI=1/C16H32N2.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;/h14-15H,3-13,16H2,1-2H3;1H |
CAS-nummer |
114569-84-5 |
Moleculaire Structuur |
|
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|