ChemNet > CAS > 116668-47-4 6-Amino-2-naphthoic acid
116668-47-4 6-Amino-2-naphthoic acid
| Naam product |
6-Amino-2-naphthoic acid |
| MF |
C11H8NO2 |
| Molecuulgewicht |
186.1873 |
| InChI |
InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1 |
| CAS-nummer |
116668-47-4 |
| Moleculaire Structuur |
|
| Smeltpunt |
222-227℃ |
| Kookpunt |
416.7°C at 760 mmHg |
| Vlampunt |
205.8°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
