ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
| Naam product |
4-(Dimethylamino)benzonitrile |
| Synoniemen |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| MF |
C9H10N2 |
| Molecuulgewicht |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| CAS-nummer |
1197-19-9 |
| EINECS |
214-819-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.04g/cm3 |
| Smeltpunt |
70-76℃ |
| Kookpunt |
318.8°C at 760 mmHg |
| Brekingsindex |
1.55 |
| Vlampunt |
145.4°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
