ChemNet > CAS > 124-10-7 Methyl myristate
124-10-7 Methyl myristate
Naam product |
Methyl myristate |
Synoniemen |
Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
MF |
C15H30O2 |
Molecuulgewicht |
242.40 |
InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
CAS-nummer |
124-10-7 |
EINECS |
204-680-1 |
Moleculaire Structuur |
|
Dichtheid |
0.863 |
Smeltpunt |
18.4-20℃ |
Kookpunt |
323℃ |
Brekingsindex |
1.434-1.438 |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|