ChemNet > CAS > 126325-46-0 6-Amino-5-bromo-2-picoline
126325-46-0 6-Amino-5-bromo-2-picoline
| Naam product |
6-Amino-5-bromo-2-picoline |
| Synoniemen |
2-amino-3-bromo-6-methylpyridine; 3-bromo-6-methylpyridin-2-amine; 2-amino-3-bromo-6-methylpyridinium |
| MF |
C6H8BrN2 |
| Molecuulgewicht |
188.0446 |
| InChI |
InChI=1/C6H7BrN2/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3,(H2,8,9)/p+1 |
| CAS-nummer |
126325-46-0 |
| Moleculaire Structuur |
|
| Kookpunt |
238.5°C at 760 mmHg |
| Vlampunt |
98.1°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
