ChemNet > CAS > 130560-97-3 3-chloro-4-fluorothiobenzamide
130560-97-3 3-chloro-4-fluorothiobenzamide
Naam product |
3-chloro-4-fluorothiobenzamide |
Synoniemen |
3-Chloro-4-fluorobenzene-1-carbothioamide; 3-chloro-4-fluorobenzenecarbothioamide |
MF |
C7H5ClFNS |
Molecuulgewicht |
189.6377 |
InChI |
InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS-nummer |
130560-97-3 |
Moleculaire Structuur |
|
Dichtheid |
1.434g/cm3 |
Smeltpunt |
129-130℃ |
Kookpunt |
285.5°C at 760 mmHg |
Brekingsindex |
1.635 |
Vlampunt |
126.5°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|