ChemNet > CAS > 13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
Naam product |
1-(3-Methylphenyl)piperazine dihydrochloride |
Synoniemen |
1-(m-Tolyl)piperazine dihydrochloride; 1-(m-Tolyl)piperazine hydrochloride; N-(3-Methylphenyl)piperazine dihydrochloride; 4-(3-methylphenyl)piperazin-1-ium |
MF |
C11H17N2 |
Molecuulgewicht |
177.2655 |
InChI |
InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3/p+1 |
CAS-nummer |
13078-13-2 |
EINECS |
235-974-8 |
Moleculaire Structuur |
|
Smeltpunt |
195-202℃ |
Kookpunt |
321.4°C at 760 mmHg |
Vlampunt |
154°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|