ChemNet > CAS > 13103-75-8 4-(2-Pyridylazo)-N,N-dimethylaniline
13103-75-8 4-(2-Pyridylazo)-N,N-dimethylaniline
Naam product |
4-(2-Pyridylazo)-N,N-dimethylaniline |
Synoniemen |
N,N-Dimethyl-4-(2-pyridinylazo)-benzenamine; trans-Pyridine-2-azo-p-dimethylaniline; N,N-dimethyl-4-[(E)-pyridin-2-yldiazenyl]aniline |
MF |
C13H14N4 |
Molecuulgewicht |
226.2771 |
InChI |
InChI=1/C13H14N4/c1-17(2)12-8-6-11(7-9-12)15-16-13-5-3-4-10-14-13/h3-10H,1-2H3/b16-15+ |
CAS-nummer |
13103-75-8 |
EINECS |
236-026-6 |
Moleculaire Structuur |
|
Dichtheid |
1.08g/cm3 |
Smeltpunt |
108-112℃ |
Kookpunt |
392.8°C at 760 mmHg |
Brekingsindex |
1.588 |
Vlampunt |
191.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|