ChemNet > CAS > 13194-67-7 4-fluoro-2-iodotoluene
13194-67-7 4-fluoro-2-iodotoluene
Naam product |
4-fluoro-2-iodotoluene |
Synoniemen |
4-Fluoro-2-iodo-1-methylbenzene |
MF |
C7H6FI |
Molecuulgewicht |
236.0254 |
InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
CAS-nummer |
13194-67-7 |
EINECS |
236-153-7 |
Moleculaire Structuur |
|
Dichtheid |
1.788g/cm3 |
Kookpunt |
205.1°C at 760 mmHg |
Brekingsindex |
1.58 |
Vlampunt |
81°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|