ChemNet > CAS > 132-86-5 1,3-Dihydroxynaphthalene
132-86-5 1,3-Dihydroxynaphthalene
Naam product |
1,3-Dihydroxynaphthalene |
Synoniemen |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
MF |
C10H8O2 |
Molecuulgewicht |
160.1693 |
InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
CAS-nummer |
132-86-5 |
EINECS |
205-079-7 |
Moleculaire Structuur |
|
Dichtheid |
1.33g/cm3 |
Smeltpunt |
123-126℃ |
Kookpunt |
361.5°C at 760 mmHg |
Brekingsindex |
1.725 |
Vlampunt |
185.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|