ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
Naam product |
Difluoromandelicacid |
Synoniemen |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
MF |
C8H6F2O3 |
Molecuulgewicht |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
CAS-nummer |
132741-29-8 |
Moleculaire Structuur |
|
Dichtheid |
1.522g/cm3 |
Smeltpunt |
92-94℃ |
Kookpunt |
320.7°C at 760 mmHg |
Brekingsindex |
1.542 |
Vlampunt |
147.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|