ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
Naam product |
2-Benzoylthiophene |
Synoniemen |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
MF |
C11H8OS |
Molecuulgewicht |
188.2456 |
InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
CAS-nummer |
135-00-2 |
EINECS |
205-169-6 |
Moleculaire Structuur |
|
Dichtheid |
1.198g/cm3 |
Kookpunt |
300°C at 760 mmHg |
Brekingsindex |
1.609 |
Vlampunt |
139.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|