ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
| Naam product |
2-Benzoylthiophene |
| Synoniemen |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
| MF |
C11H8OS |
| Molecuulgewicht |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| CAS-nummer |
135-00-2 |
| EINECS |
205-169-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.198g/cm3 |
| Kookpunt |
300°C at 760 mmHg |
| Brekingsindex |
1.609 |
| Vlampunt |
139.7°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
