ChemNet > CAS > 135306-45-5 3,5-difluoropropiophenone
135306-45-5 3,5-difluoropropiophenone
| Naam product |
3,5-difluoropropiophenone |
| Synoniemen |
1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
| MF |
C9H8F2O |
| Molecuulgewicht |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
| CAS-nummer |
135306-45-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.179g/cm3 |
| Smeltpunt |
25-27℃ |
| Kookpunt |
191.5°C at 760 mmHg |
| Brekingsindex |
1.472 |
| Vlampunt |
70.6°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
