ChemNet > CAS > 13629-22-6 9-Fluorenone hydrazone
13629-22-6 9-Fluorenone hydrazone
| Naam product |
9-Fluorenone hydrazone |
| Synoniemen |
Fluorenone hydrazone
; 9H-Fluoren-9-one hydrazone; 9H-fluoren-9-ylidenehydrazine |
| MF |
C13H10N2 |
| Molecuulgewicht |
194.2319 |
| InChI |
InChI=1/C13H10N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,14H2 |
| CAS-nummer |
13629-22-6 |
| EINECS |
237-116-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.23g/cm3 |
| Smeltpunt |
149-150℃ |
| Kookpunt |
362.5°C at 760 mmHg |
| Brekingsindex |
1.682 |
| Vlampunt |
173°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
