ChemNet > CAS > 13631-21-5 4-Bromo-3-chlorophenol
13631-21-5 4-Bromo-3-chlorophenol
| Naam product |
4-Bromo-3-chlorophenol |
| MF |
C6H4BrClO |
| Molecuulgewicht |
207.4524 |
| InChI |
InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| CAS-nummer |
13631-21-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.788g/cm3 |
| Kookpunt |
267.5°C at 760 mmHg |
| Brekingsindex |
1.619 |
| Vlampunt |
115.6°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
