ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
Naam product |
2-acetyl-3-methylthiophene |
Synoniemen |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
MF |
C7H8OS |
Molecuulgewicht |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
CAS-nummer |
13679-72-6 |
EINECS |
237-179-1 |
Moleculaire Structuur |
|
Dichtheid |
1.106g/cm3 |
Kookpunt |
214.9°C at 760 mmHg |
Brekingsindex |
1.535 |
Vlampunt |
92.3°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|