ChemNet > CAS > 13816-33-6 4-Isopropylbenzonitrile
13816-33-6 4-Isopropylbenzonitrile
Naam product |
4-Isopropylbenzonitrile |
Synoniemen |
4-Cyanocumene; 4-(propan-2-yl)benzonitrile |
MF |
C10H11N |
Molecuulgewicht |
145.201 |
InChI |
InChI=1/C10H11N/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,1-2H3 |
CAS-nummer |
13816-33-6 |
EINECS |
237-492-3 |
Moleculaire Structuur |
|
Dichtheid |
0.96g/cm3 |
Kookpunt |
231.5°C at 760 mmHg |
Brekingsindex |
1.515 |
Vlampunt |
93.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|