ChemNet > CAS > 139669-95-7 2,4-Dibromo-thiazole-5-carbaldehyde
139669-95-7 2,4-Dibromo-thiazole-5-carbaldehyde
Naam product |
2,4-Dibromo-thiazole-5-carbaldehyde |
Synoniemen |
2,4-dibromo-1,3-thiazole-5-carbaldehyde |
MF |
C4HBr2NOS |
Molecuulgewicht |
270.9298 |
InChI |
InChI=1/C4HBr2NOS/c5-3-2(1-8)9-4(6)7-3/h1H |
CAS-nummer |
139669-95-7 |
Moleculaire Structuur |
|
Dichtheid |
2.332g/cm3 |
Smeltpunt |
99.8℃ |
Kookpunt |
317°C at 760 mmHg |
Brekingsindex |
1.699 |
Vlampunt |
145.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|