CAS No: 13988-26-6, Chemical Name: 3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione
the physical and chemical property of 13988-26-6, 3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione is provided by ChemNet.com
ChemNet > CAS > 13988-26-6 3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione
13988-26-6 3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione
| Naam product |
3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione |
| Synoniemen |
2,5,8-Benzotrioxacycloundecin-1,9-dione, 3,4,6,7-tetrahydro-; BRN 1380048; Diethylene glycol bisphthalate; 3,4,6,7-Tetrahydro-2,5,8-benzotrioxacycloundecin-1,9-dione; Phthalic acid, cyclic oxydiethylene ester; 3,4,6,7-tetrahydro-2,5,8-benzotrioxacycloundecine-1,9-dione |
| MF |
C12H12O5 |
| Molecuulgewicht |
236.2207 |
| InChI |
InChI=1/C12H12O5/c13-11-9-3-1-2-4-10(9)12(14)17-8-6-15-5-7-16-11/h1-4H,5-8H2 |
| CAS-nummer |
13988-26-6 |
| EINECS |
237-784-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.236g/cm3 |
| Kookpunt |
500°C at 760 mmHg |
| Brekingsindex |
1.512 |
| Vlampunt |
228°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
