ChemNet > CAS > 14548-48-2 4-(4-Chlorobenzoyl)pyridine
14548-48-2 4-(4-Chlorobenzoyl)pyridine
| Naam product |
4-(4-Chlorobenzoyl)pyridine |
| Synoniemen |
4-Chlorophenyl 4-pyridyl ketone; 4-chlorophenyl pyridine-4-yl ketone; (4-chlorophenyl)(pyridin-4-yl)methanone |
| MF |
C12H8ClNO |
| Molecuulgewicht |
217.651 |
| InChI |
InChI=1/C12H8ClNO/c13-11-3-1-9(2-4-11)12(15)10-5-7-14-8-6-10/h1-8H |
| CAS-nummer |
14548-48-2 |
| EINECS |
238-587-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.26g/cm3 |
| Smeltpunt |
107-110℃ |
| Kookpunt |
357.3°C at 760 mmHg |
| Brekingsindex |
1.599 |
| Vlampunt |
169.9°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
