ChemNet > CAS > 14804-31-0 Bromomethoxytoluene
14804-31-0 Bromomethoxytoluene
Naam product |
Bromomethoxytoluene |
Synoniemen |
5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
MF |
C8H9BrO |
Molecuulgewicht |
201.0605 |
InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
CAS-nummer |
14804-31-0 |
Moleculaire Structuur |
|
Dichtheid |
1.378g/cm3 |
Smeltpunt |
66-69℃ |
Kookpunt |
226.1°C at 760 mmHg |
Brekingsindex |
1.535 |
Vlampunt |
102.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|