ChemNet > CAS > 15088-78-5 Phenylacetyl Disulphide
15088-78-5 Phenylacetyl Disulphide
| Naam product |
Phenylacetyl Disulphide |
| Synoniemen |
Phenylacetyl Disulfide; Bis(phenylacetyl) disulphide; PADS; Phenylacetyldisulfide; dibenzyldithioperoxyanhydride |
| MF |
C16H14O2S2 |
| Molecuulgewicht |
302.4112 |
| InChI |
InChI=1/C16H14O2S2/c17-15(11-13-7-3-1-4-8-13)19-20-16(18)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| CAS-nummer |
15088-78-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.269g/cm3 |
| Smeltpunt |
59-63℃ |
| Kookpunt |
481.1°C at 760 mmHg |
| Brekingsindex |
1.638 |
| Vlampunt |
210.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
