ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
Naam product |
4-(difluoromethoxy)nitrobenzene |
Synoniemen |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
MF |
C7H5F2NO2 |
Molecuulgewicht |
173.1169 |
InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
CAS-nummer |
1544-86-1 |
Moleculaire Structuur |
|
Dichtheid |
1.339g/cm3 |
Smeltpunt |
33-110℃ |
Kookpunt |
240.7°C at 760 mmHg |
Brekingsindex |
1.5 |
Vlampunt |
111.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|