ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
| Naam product |
4-(difluoromethoxy)nitrobenzene |
| Synoniemen |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| MF |
C7H5F2NO2 |
| Molecuulgewicht |
173.1169 |
| InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| CAS-nummer |
1544-86-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.339g/cm3 |
| Smeltpunt |
33-110℃ |
| Kookpunt |
240.7°C at 760 mmHg |
| Brekingsindex |
1.5 |
| Vlampunt |
111.9°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
