ChemNet > CAS > 158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
Naam product |
4-Amino-3-chloro-5-methylbenzonitrile |
Synoniemen |
2-Chloro-4-cyano-6-methylaniline |
MF |
C8H7ClN2 |
Molecuulgewicht |
166.6076 |
InChI |
InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
CAS-nummer |
158296-69-6 |
Moleculaire Structuur |
|
Dichtheid |
1.27g/cm3 |
Kookpunt |
302°C at 760 mmHg |
Brekingsindex |
1.594 |
Vlampunt |
136.5°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|