ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
Naam product |
Cyclohexanone 2,4-dinitrophenylhydrazone |
Synoniemen |
Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
MF |
C12H14N4O4 |
Molecuulgewicht |
278.264 |
InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
CAS-nummer |
1589-62-4 |
EINECS |
216-458-1 |
Moleculaire Structuur |
|
Dichtheid |
1.47g/cm3 |
Smeltpunt |
159-161℃ |
Kookpunt |
434.6°C at 760 mmHg |
Brekingsindex |
1.665 |
Vlampunt |
216.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|