ChemNet > CAS > 15965-54-5 2-Chloro-5-methoxybenzimidazole
15965-54-5 2-Chloro-5-methoxybenzimidazole
Naam product |
2-Chloro-5-methoxybenzimidazole |
Synoniemen |
2-chloro-6-methoxy-1H-benzimidazole |
MF |
C8H7ClN2O |
Molecuulgewicht |
182.607 |
InChI |
InChI=1/C8H7ClN2O/c1-12-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3,(H,10,11) |
CAS-nummer |
15965-54-5 |
Moleculaire Structuur |
|
Dichtheid |
1.393g/cm3 |
Kookpunt |
365.7°C at 760 mmHg |
Brekingsindex |
1.656 |
Vlampunt |
175°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|