ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
Naam product |
3-Chloro-4-fluorobenzyl alcohol |
Synoniemen |
(3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
MF |
C7H6ClFO |
Molecuulgewicht |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
CAS-nummer |
161446-90-8 |
Moleculaire Structuur |
|
Dichtheid |
1.344g/cm3 |
Kookpunt |
242.5°C at 760 mmHg |
Brekingsindex |
1.542 |
Vlampunt |
100.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|