ChemNet > CAS > 162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
Naam product |
2-Fluoro-4-methoxybenzeneboronic acid |
Synoniemen |
2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
MF |
C7H8BFO3 |
Molecuulgewicht |
169.946 |
InChI |
InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
CAS-nummer |
162101-31-7 |
Moleculaire Structuur |
|
Dichtheid |
1.265g/cm3 |
Kookpunt |
291.169°C at 760 mmHg |
Brekingsindex |
1.504 |
Vlampunt |
129.895°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|