ChemNet > CAS > 162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
| Naam product |
2-Fluoro-4-methoxybenzeneboronic acid |
| Synoniemen |
2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
| MF |
C7H8BFO3 |
| Molecuulgewicht |
169.946 |
| InChI |
InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
| CAS-nummer |
162101-31-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.265g/cm3 |
| Kookpunt |
291.169°C at 760 mmHg |
| Brekingsindex |
1.504 |
| Vlampunt |
129.895°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
