CAS No: 162320-67-4, Chemical Name: 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine
the physical and chemical property of 162320-67-4, 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine is provided by ChemNet.com
ChemNet > CAS > 162320-67-4 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine
162320-67-4 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine
| Naam product |
3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| Synoniemen |
162320-67-4; 3-(2-Chlorophényl)-6-(2,6-difluorophényl)-1,2,4,5-tétrazine; 3-(2-Chlorphenyl)-6-(2,6-difluorphenyl)-1,2,4,5-tetrazin; diflovidazin |
| MF |
C14H7ClF2N4 |
| Molecuulgewicht |
304.682 |
| InChI |
InChI=1/C14H7ClF2N4/c15-9-5-2-1-4-8(9)13-18-20-14(21-19-13)12-10(16)6-3-7-11(12)17/h1-7H |
| CAS-nummer |
162320-67-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.428g/cm3 |
| Kookpunt |
471°C at 760 mmHg |
| Brekingsindex |
1.597 |
| Vlampunt |
238.6°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
