ChemNet > CAS > 16588-06-0 4-Chloro-3-nitrobenzamide
16588-06-0 4-Chloro-3-nitrobenzamide
Naam product |
4-Chloro-3-nitrobenzamide |
Synoniemen |
Benzamide, 4-chloro-3-nitro-; 3-Nitro-4-chlorobenzamide; 4-09-00-01227 (Beilstein Handbook Reference); 4-Chlor-3-nitrobenzamid; 4-Chlor-3-nitrobenzamid [Czech]; BRN 0645210; NSC 127825 |
MF |
C7H5ClN2O3 |
Molecuulgewicht |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
CAS-nummer |
16588-06-0 |
EINECS |
240-644-1 |
Moleculaire Structuur |
|
Dichtheid |
1.52g/cm3 |
Kookpunt |
315.6°C at 760 mmHg |
Brekingsindex |
1.624 |
Vlampunt |
144.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|