ChemNet > CAS > 16703-52-9 Ethyl NN-Dimethyloxamate
16703-52-9 Ethyl NN-Dimethyloxamate
Naam product |
Ethyl NN-Dimethyloxamate |
Synoniemen |
Ethyl N,N-dimethyloxamate; N,N-Dimethyloxamic acid ethyl ester; ethyl (dimethylamino)(oxo)acetate; Ethyl-N,N-dimethyl oxamate |
MF |
C6H11NO3 |
Molecuulgewicht |
145.1564 |
InChI |
InChI=1/C6H11NO3/c1-4-10-6(9)5(8)7(2)3/h4H2,1-3H3 |
CAS-nummer |
16703-52-9 |
EINECS |
240-755-5 |
Moleculaire Structuur |
|
Dichtheid |
1.071g/cm3 |
Kookpunt |
176.6°C at 760 mmHg |
Brekingsindex |
1.435 |
Vlampunt |
60.6°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|