ChemNet > CAS > 167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
| Naam product |
1-Bromo-2,5-difluoro-4-nitrobenzene |
| Synoniemen |
4-Bromo-2,5-difluoronitrobenzene |
| MF |
C6H2BrF2NO2 |
| Molecuulgewicht |
237.9864 |
| InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| CAS-nummer |
167415-27-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.89g/cm3 |
| Kookpunt |
262.4°C at 760 mmHg |
| Brekingsindex |
1.556 |
| Vlampunt |
112.5°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
