ChemNet > CAS > 16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
Naam product |
3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
Synoniemen |
3-Bromo-5-nitrosalicylaldehyde |
MF |
C7H4BrNO4 |
Molecuulgewicht |
246.015 |
InChI |
InChI=1/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
CAS-nummer |
16789-84-7 |
Moleculaire Structuur |
|
Dichtheid |
1.928g/cm3 |
Kookpunt |
299.6°C at 760 mmHg |
Brekingsindex |
1.696 |
Vlampunt |
135°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|