ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| Naam product |
3-Fluoro-4-methylbenzonitrile |
| Synoniemen |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| MF |
C8H6FN |
| Molecuulgewicht |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| CAS-nummer |
170572-49-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.117g/cm3 |
| Smeltpunt |
48-50℃ |
| Kookpunt |
215.069°C at 760 mmHg |
| Brekingsindex |
1.508 |
| Vlampunt |
90.3°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
