ChemNet > CAS > 17135-78-3 2-Chloroanthracene
17135-78-3 2-Chloroanthracene
Naam product |
2-Chloroanthracene |
Synoniemen |
Anthracene, 2-chloro-; 4-05-00-02292 (Beilstein Handbook Reference); AI3-23450; BRN 2047055; CCRIS 5549; NSC 408454 |
MF |
C14H9Cl |
Molecuulgewicht |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
CAS-nummer |
17135-78-3 |
Moleculaire Structuur |
|
Dichtheid |
1.253g/cm3 |
Smeltpunt |
221-223℃ |
Kookpunt |
370.1°C at 760 mmHg |
Brekingsindex |
1.717 |
Vlampunt |
179.2°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|